| Cas No.: | 33396-29-1 |
| Chemical Name: | Erythromycin A enol ether |
| SMILES: | C[C@@](OC([C@@H]([C@H]([C@](O)1C)O)C)=C2C)(C2)[C@@H]([C@H]([C@@H]([C@H](C(O[C@@H]1CC)=O)C)O[C@H](O[C@H]3C)C[C@](C)([C@H]3O)OC)C)O[C@H](O[C@@H]4C)[C@@H]([C@H](C4)N(C)C)O |
| Formula: | C37H65NO12 |
| M.Wt: | 715.91 |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
