Cas No.: | 1609402-14-3 |
Chemical Name: | N-(4-{3-[5-(Dimethylamino)naphthalene-1-sulfonamido]phenyl}thiazol-2-yl)acetamide |
Synonyms: | HA15;HA-15;N-[4-[3-[[[5-(Dimethylamino)-1-naphthalenyl]sulfonyl]amino]phenyl]-2-thiazolyl]-acetamide;N-(4-(3-((5-(dimethylamino)naphthalene)-1-sulfonamido)phenyl)thiazol-2-yl)acetamide;HA15 pound>>HA 15;BCP28914;NSC782989;s8299;HA15, >=98% (HPLC);AK685666;J3.606.144H;Q27225657;N-(4-{3-[5-(dimethylamino)naphthalene-1-sulfonamido]phenyl}thiazol-2-yl)acetamide;N-{4-[3-({[5-(dimethylamino)-1-naphthyl]sulfonyl}amino)phenyl]-1,3-thiazol-2-yl}acetam |
SMILES: | S(C1=C([H])C([H])=C([H])C2C(=C([H])C([H])=C([H])C=21)N(C([H])([H])[H])C([H])([H])[H])(N([H])C1=C([H])C([H])=C([H])C(C2=C([H])SC(N([H])C(C([H])([H])[H])=O)=N2)=C1[H])(=O)=O |
Formula: | C23H22N4O3S2 |
M.Wt: | 466.5758 |
Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
Description: | HA15 is a molecule that targets specifically BiP/GRP78/HSPA5target: BiP, GRP78, HSPA5 [1]In vitro: HA15 induces ER stress leading to cancer cell death. kills cancer cells by targeting BiP to increase ER stress, leading to melanoma cell death by concomitant induction of autophagic and apoptotic mechanisms. HA15 exhibits strong efficacy in melanoma cells. The 50% inhibitory concentration (IC50) in A375 cells was between 1 and 2.5 mM HA15. [1]In vivo: HA15 induces ER stress leading to cancer cell death. HA15 also exhibited strong efficacy in xenograft mouse models with melanoma cellseither sensitive or resistant to BRAF inhibitors. [1] |