| Cas No.: | 596-85-0 |
| Chemical Name: | Manool |
| SMILES: | CC(CCC1)(C)[C@]([C@@]1(C)[C@H]2CC[C@](O)(C)C=C)([H])CCC2=C |
| Formula: | C20H34O |
| M.Wt: | 290.48 |
| Sotrage: | 4°C, stored under nitrogen*In solvent : -80°C, 6 months; -20°C, 1 month (stored under nitrogen) |
To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 596-85-0 |
| Chemical Name: | Manool |
| SMILES: | CC(CCC1)(C)[C@]([C@@]1(C)[C@H]2CC[C@](O)(C)C=C)([H])CCC2=C |
| Formula: | C20H34O |
| M.Wt: | 290.48 |
| Sotrage: | 4°C, stored under nitrogen*In solvent : -80°C, 6 months; -20°C, 1 month (stored under nitrogen) |