| Cas No.: | 196078-30-5 |
| Chemical Name: | Pramlintide Acetate Hydrate |
| Synonyms: | Pramlintide Acetate;Pramlintide;Pramlintide Acetate Hydrate;Tripo-aMylin Acetate Hydrate;Pramlintide Acetate, Amylin Rat;AC-137 Acetate Hydrate, SyMlin Acetate Hydrate;25-L-Proline-28-L-proline-29-L-proline-aMylin (huMan) Acetate Hydrate;AMYLIN (HUMAN), 25-L-PROLINE-28-L-PROLINE-29-L-PROLINE-, ACETATE (SALT), HYDRATE;pramlintide acetate;pramlintide acetate hydrate;Pramlintide?Acetate impurity;Pramlintide acetate hydrate |
| SMILES: | CCC(C(NC(C1N(C(CNC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(N)CCCCN)=O)CS)=O)CC(N)=O)=O)C(O)C)=O)C)=O)C(O)C)=O)CS)=O)C)=O)C(O)C)=O)CCC(N)=O)=O)CCCNC(N)=N)=O)CC(C)C)=O)C)=O)CC(N)=O)=O)CC2=CC=CC=C2)=O)CC(C)C)=O)C(C)C)=O)CC2N=CNC=2)=O)CO)=O)CO)=O)CC(N)=O)=O)CC(N)=O)=O)CC2=CC=CC=C2)=O)=O)CCC1)=O)C(NC(C(N1C(C(N2C(C(NC(C(NC(C(NC(C(NCC(NC(C(NC(C(NC(C(NC(C(N)=O)CC3=CC=C(O)C=C3)=O)C(O)C)=O)CC(N)=O)=O)CO)=O)=O)C(C)C)=O)CC(N)=O)=O)C(O)C)=O)CCC2)=O)CCC1)=O)CC(C)C)=O)C |
| Formula: | C171H267N51O53S2.X(C2H4 |
| M.Wt: | 3949.39 |
| Purity: | >97% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Pramlintide is an analogue of amylin, a small peptide hormone that is released into the bloodstream by the β cells of the pancreas along with insulin after a meal. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
