| Cas No.: | 51543-39-6 |
| Chemical Name: | (S)-Flurbiprofen |
| SMILES: | O=C(O)[C@@H](C)C1=CC=C(C2=CC=CC=C2)C(F)=C1 |
| Formula: | C15H13FO2 |
| M.Wt: | 244.26 |
| Sotrage: | Powder-20°C3 years4°C2 yearsIn solvent-80°C6 months-20°C1 month |
To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 51543-39-6 |
| Chemical Name: | (S)-Flurbiprofen |
| SMILES: | O=C(O)[C@@H](C)C1=CC=C(C2=CC=CC=C2)C(F)=C1 |
| Formula: | C15H13FO2 |
| M.Wt: | 244.26 |
| Sotrage: | Powder-20°C3 years4°C2 yearsIn solvent-80°C6 months-20°C1 month |