| Cas No.: | 1496552-28-3 |
| Chemical Name: | Sofosbuvir impurity C |
| SMILES: | O=[P@@](N[C@H](C)C(OC(C)C)=O)(OC[C@@H]1[C@@H](O)[C@](F)(C)[C@H](N2C=CC(NC2=O)=O)O1)OC3=CC=CC=C3 |
| Formula: | C22H29FN3O9P |
| M.Wt: | 529.45 |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
