| Cas No.: | 37804-11-8 |
| Chemical Name: | 3-Amino-6-chloro-5-(dimethylamino)-N-(pyridin-3-yl)pyrazine-2-carboxamide Hydrochloride |
| Synonyms: | ACDPP HCl |
| SMILES: | O=C(C1=NC(Cl)=C(N(C)C)N=C1N)NC2=CC=CN=C2.[H]Cl |
| Formula: | C12H14Cl2N6O |
| M.Wt: | 329.19 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
