| Cas No.: | 2379572-34-4 |
| Chemical Name: | Golcadomide |
| Synonyms: | (S)-2-(2,6-Dioxopiperidin-3-yl)-4-[[2-fluoro-4-[(3-morpholinoazetidin-1-yl)methyl]benzyl]amino]isoindoline-1,3-dione;CC 1007548;Golcadomide |
| SMILES: | C12=C(C(N([C@H]3CCC(NC3=O)=O)C1=O)=O)C(NCC1=C(F)C=C(C=C1)CN1CC(C1)N1CCOCC1)=CC=C2 |
| Formula: | C28H30FN5O5 |
| M.Wt: | 535.57 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
