| Cas No.: | 1627710-30-8 |
| Chemical Name: | (2Z)-2-[(3-[(4-Chlorophenyl)methoxy]phenyl)methylidene]-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-3-one |
| Synonyms: | CID-85469571; CID85469571; CID 85469571; GPR18-IN-32; GPR18 IN 32; GPR18IN32 |
| SMILES: | O=C(N1C(SCCC1)=N/2)C2=CC3=CC=CC(OCC4=CC=C(Cl)C=C4)=C3 |
| Formula: | C120H17ClN2O2S |
| M.Wt: | 384.88 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
