| Cas No.: | 394237-61-7 |
| Chemical Name: | 4-(4-(4-methoxyphenyl)-5-methyl-1H-pyrazol-3-yl)benzene-1,3-diol |
| Synonyms: | M77976; M-77976; M 77976. |
| SMILES: | COC1=CC=C(C2=C(C)NN=C2C3=CC=C(O)C=C3O)C=C1 |
| Formula: | C17H16N2O3 |
| M.Wt: | 296.33 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
