| Cas No.: | 939791-41-0 |
| Chemical Name: | N-methyl-N-(3-(((2-((2-oxoindolin-5-yl)amino)-5-(trifluoromethyl)pyrimidin-4-yl)amino)methyl)pyridin-2-yl)methanesulfonamide hydrochloride |
| Synonyms: | PF562271; PF562271; PF-562271; PF562,271; PF562,271; PF-562,271; PF-00562271; PF00562271; PF 00562271; PF562271 hydrochloride. PF271, PF-271, PF 271IUPAC/Chemical Name:InChi Key:InChi Code:SMILES Code: |
| SMILES: | CS(=O)(N(C)C1=NC=CC=C1CNC2=NC(NC3=CC4=C(NC(C4)=O)C=C3)=NC=C2C(F)(F)F)=O.[H]Cl |
| Formula: | C21H21ClF3N7O3S |
| M.Wt: | 543.95 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
