| Cas No.: | 155653-86-4 |
| Chemical Name: | Siaresinolic acid 28-O-β-D-glucopyranosyl ester |
| SMILES: | OC[C@H]([C@H]([C@@H]([C@H]1O)O)O)O[C@H]1OC([C@]23[C@]([C@@H](C(C)(CC3)C)O)([H])C4=CC[C@@]([C@@]5([C@@](C(C)([C@H](CC5)O)C)([H])CC6)C)([H])[C@]6(C)[C@@]4(CC2)C)=O |
| Formula: | C36H58O9 |
| M.Wt: | 634.84 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
