| Cas No.: | 515814-01-4 |
| Chemical Name: | Voclosporin |
| Synonyms: | Voclosporin;Voclosporin [usan];Voclosporin Discont;Voclosporin Discontinued;ISA-247;ISAtx-247;R-1524 |
| SMILES: | C=C/C=C/C[C@@H](C)[C@H]([C@]1([H])N(C([C@](N(C([C@@H](N(C([C@](N(C([C@H](NC([C@@H](NC([C@H](CC(C)C)N(C)C([C@@](C(C)C)([H])NC([C@H](CC(C)C)N(C)C(CN(C)C([C@H](CC)NC1=O)=O)=O)=O)=O)=O)C)=O)C)=O)C)([H])CC(C)C)=O)C)CC(C)C)=O)C)([H])C(C)C)=O)C)O |
| Formula: | C63H111N11O12 |
| M.Wt: | 1214.62 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
