| Cas No.: | 1263893-98-6 |
| Chemical Name: | 2-((2-Amino-9-(2-(diethylamino)ethyl)-9H-purin-6-yl)thio)acetic acid hydrochloride |
| Synonyms: | zr172 HCl; zr17-2 HCl; zr17 2 HCl; zr172 Hydrochloride; zr17-2 Hydrochloride; zr17 2 Hydrochloride |
| SMILES: | O=C(O)CSC1=C2N=CN(CCN(CC)CC)C2=NC(N)=N1.[H]Cl |
| Formula: | C13H20N6O2SHCl |
| M.Wt: | 360.86 |
| Sotrage: | 0°C (short term), -20°C (long term), desiccated |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
