| Cas No.: | 2064292-52-8 |
| Chemical Name: | (2S,4R)-1-((S)-17-Amino-2-(tert-butyl)-4-oxo-6,9,12,15-tetraoxa-3-azaheptadecanoyl)-4-hydroxy-N-(4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide Hydrochloride |
| Synonyms: | VH-03 linker; VH 03 linker; VH03 linker; VH03-linker |
| SMILES: | O=C([C@H]1N(C([C@H](C(C)(C)C)NC(COCCOCCOCCOCCN)=O)=O)C[C@H](O)C1)NCC2=CC=C(C3=C(C)N=CS3)C=C2.[H]Cl |
| Formula: | C32H50ClN5O8S |
| M.Wt: | 700.29 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks4°C in DMSO,6 months-80°C in DMSO |
| Publication: | [1]. Crew, Andrew P, et al. MDM2-BASED MODULATORS OF PROTEOLYSIS AND ASSOCIATED METHODS OF USE. US20170008904A1. |
| Description: | E3 ligase Ligand-Linker Conjugates 7 is a synthesized compound that incorporates an E3 ligase ligand and a linker used in PROTAC technology. |
| Target: | E3 Ligase Ligand-Linker Conjugate[1] |
| In Vitro: | E3 ligase Ligand-Linker Conjugates 7 is from patent US20170008904, example 3, 0376. E3 ligase Ligand-Linker Conjugates 7 is part of compound A1895[1]. |
| References: | [1]. US20170008904 |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
