| Cas No.: | 290815-26-8 |
| Synonyms: | Ro 67-0565; SPP-301 |
| SMILES: | COC1=C(OC(C(NS(C2=NC=C(C=C2)C)(=O)=O)=NC(C3=CC=NC=C3)=N4)=C4OC)C=CC=C1 |
| Formula: | C23H21N5O5S |
| M.Wt: | 479.5083 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Avosentan(Ro 67-0565; SPP-301) is a potent, selective endothelin receptor(ETA receptor) antagonist. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
