| Cas No.: | 1257213-50-5 |
| Chemical Name: | Bms-986020 |
| Synonyms: | BMS-986020;AM152;AM-152;BMS 986020;38CTP01B4L;(R)-1-(4'-(3-Methyl-4-(((1-phenylethoxy)carbonyl)amino)isoxazol-5-yl)-[1,1'-biphenyl]-4-yl)cyclopropane-1-carboxylic acid;1-[4-[4-[3-methyl-4-[[(1R)-1-phenylethoxy]carbonylamino]-1,2-oxazol-5-yl]phenyl]phenyl]cyclopropane-1-carboxylic acid;Cyclopropanecarboxylic acid, 1-(4'-(3-methyl-4-((((1R)-1-phenylethoxy)carbonyl)amino)-5-isoxazolyl)(1,1'-biphenyl)-4-yl)-;Cyclopropanecarboxylic acid, 1-[4'-[3-methyl-4-[[[(1R)-1-phenyl |
| SMILES: | O([H])C(C1(C2C([H])=C([H])C(C3C([H])=C([H])C(C4=C(C(C([H])([H])[H])=NO4)N([H])C(=O)O[C@]([H])(C([H])([H])[H])C4C([H])=C([H])C([H])=C([H])C=4[H])=C([H])C=3[H])=C([H])C=2[H])C([H])([H])C1([H])[H])=O |
| Formula: | C29H26N2O5 |
| M.Wt: | 482.5271 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | BMS-986020 is an LPA1 antagonist.target: LPA1BMS-986020 is in Phase 2 clinical development for treating idiopathic pulmonary fibrosis. BMS-986020 selectively inhibits the LPA receptor, which is involved in binding of the signaling molecule lysophosphatidic acid, which in turn is involved in a host of diverse biological functions, such as cell proliferation, platelet aggregation, smooth muscle contraction and others. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
