| Cas No.: | 250612-42-1 | 
| Chemical Name: | Cyclo(RGDyK) trifluoroacetate | 
| Synonyms: | Cyclic Arg-Gly-Asp-D-Tyr-Lys;Cyclo(RGDyK);AK685805;Cyclo(RGDyK) trifluoroacetate | 
| SMILES: | FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.O=C1C(CCCCN)NC(C(CC2C=CC(=CC=2)O)NC(C(CC(=O)O)NC(CNC(C(CCC/N=C(\N)/N)N1)=O)=O)=O)=O | 
| Formula: | C31H43F6N9O12 | 
| M.Wt: | 847.716648340225 | 
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO | 
| Description: | Cyclo(RGDyK) trifluoroacetate is a potent and selective αVβ3 integrin inhibitor with an IC50 of 20 nM. | 
| In Vitro: | Cyclo(RGDyK) (c(RGDyK(SAA)) shows high affinity and selectivity for αVβ3 over αVβ5 (IC50=4000 nM) and αIIbβ3 (IC50=3000 nM)[1]. | 

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
            