| Cas No.: | 1835256-48-8 |
| Chemical Name: | 1-[2-[(3R,4S)-1-[(3S,4S)-1-Cyclopentyl-3-fluoro-4-(4-methoxyphenyl)pyrrolidine-3-carbonyl]-4-(methoxymethyl)pyrrolidin-3-yl]-5-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid |
| Synonyms: | Dersimelagon;1-[2-[(3R,4S)-1-[(3S,4S)-1-Cyclopentyl-3-fluoro-4-(4-methoxyphenyl)pyrrolidine-3-carbonyl]-4-(methox |
| SMILES: | F[C@]1(C(N2C[C@@H](COC)[C@H](C3=CC=C(C(F)(F)F)C=C3N3CCC(C(=O)O)CC3)C2)=O)CN(C[C@@H]1C1C=CC(=CC=1)OC)C1CCCC1 |
| Formula: | C36H45F4N3O5 |
| M.Wt: | 675.753224134445 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Dersimelagon, also known as MT-7117 and WHO 10832, is a novel, orally-administered, small molecule, selective melanocortin-1 receptor (MC1R) agonist that increases skin melanin without sun exposure and is being developed to increase light tolerance in EPP/XLP patients. Dersimelagon significantly boosted sunlight tolerance in patients with erythropoietic protoporphyria in a multicenter, phase 2, randomized trial. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
.jpg)