| Cas No.: | 2055990-82-2 |
| Chemical Name: | 5-(((3S,4R)-4-(4-fluorophenyl)piperidin-3-yl)methoxy)-1H-indazole |
| Synonyms: | CCG224061;CCG-224061 |
| SMILES: | N1C2=C(C=C(OC[C@@H]3[C@@H](C4=CC=C(F)C=C4)CCNC3)C=C2)C=N1 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, relatively selective G protein-coupled receptor kinase GRK2 inhibitor with IC50 of 66 nM; displays >30-fold selectivity over GRK5, GRK1, PKA and ROCK1. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
