| Cas No.: | 1699861-37-4 |
| Chemical Name: | 3-((5-((4-aminopiperidin-1-yl)methyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl)amino)-5-(2-isopropyl-2H-tetrazol-5-yl)phenol |
| Synonyms: | BMS 901715;BMS901715 |
| SMILES: | C(O)1=CC(C2=NN(C(C)C)N=N2)=CC(NC2C3=C(CN4CCC(N)CC4)C=CN3N=CN=2)=C1 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | BMS-901715 is a potent, selective adapter protein-2 associated kinase 1 (AAK1) inhibitor. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
