| Cas No.: | 1797406-80-4 |
| Chemical Name: | (S,R,S)-AHPC-PEG3-N3 |
| Synonyms: | E3 ligase Ligand-Linker Conjugates 12;(2S,4R)-1-((S)-14-azido-2-(tert-butyl)-4-oxo-6,9,12-trioxa-3-azatetradecanoyl)-4-hydroxy-N-(4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide;Crosslinker−E3 Ligase ligand conjugate;Partial PROTAC;Template for synthesis of targeted protein degrader;VH032 conjugate;(S,R,S)-AHPC-PEG3-N3;VHL Ligand-Linker Conjugates 8;(2S,4R)-1-[(2S)-2-[[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetyl]amino]-3,3-dimethylbutanoyl]-4-hydroxy-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES: | S1C=NC(C)=C1C1C=CC(=CC=1)CNC([C@@H]1C[C@H](CN1C([C@H](C(C)(C)C)NC(COCCOCCOCCN=[N+]=[N-])=O)=O)O)=O |
| Formula: | C30H43N7O7S |
| M.Wt: | 645.77 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
-AHPC-PEG3-N3.gif)