| Cas No.: | 1443461-21-9 |
| Chemical Name: | 4-(((3aR,5aR,5bR,7aR,9S,11aR,11bR,13aS)-3a-((R)-2-((3-chlorobenzyl)(2-(dimethylamino)ethyl)amino)-1-hydroxyethyl)-1-isopropyl-5a,5b,8,8,11a-pentamethyl-2-oxo-3,3a,4,5,5a,5b,6,7,7a,8,9,10,11,11a,11b,12,13,13a-octadecahydro-2H-cyclopenta[a]chrysen-9-yl)oxy) |
| Synonyms: | GSK2838232; GSK-2838232; GSK 2838232. |
| SMILES: | O=C(O)C(C)(C)CC(O[C@@H](CC[C@]1(C)[C@@]2([H])CC[C@@]34[H])C(C)(C)[C@]1([H])CC[C@@]2(C)[C@]3(C)CC[C@]5([C@@H](O)CN(CC6=CC=CC(Cl)=C6)CCN(C)C)C4=C(C(C)C)C(C5)=O)=O |
| Formula: | C48H73ClN2O6 |
| M.Wt: | 809.57 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | GSK2838232 is a novel human immune virus (HIV) maturation inhibitor being developed for the treatment of chronic HIV infection. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
