| Cas No.: | 1351586-50-9 |
| Chemical Name: | L319 |
| Synonyms: | di((Z)-non-2-en-1-yl) 9-((4-(dimethylamino)butanoyl)oxy)heptadecanedioate;bis[(Z)-non-2-enyl] 9-[4-(dimethylamino)butanoyloxy]heptadecanedioate;L319;starbld0004010;DA-64994;DGNMJYUPWDTKJB-ZDSKVHJSSA-N;LIPID L319?;EX-A5248;G16737;1351586-50-9;CS-0188740;MS-31081;GLXC-25938;LIPID L319;BP-28064;HY-139298;SCHEMBL517530;L-319, L 319 , Lipid 319, lipid-319 |
| SMILES: | O(C(CCCN(C)C)=O)C(CCCCCCCC(=O)OC/C=C\CCCCCC)CCCCCCCC(=O)OC/C=C\CCCCCC |
| Formula: | C41H75NO6 |
| M.Wt: | 678.037313699722 |
| Purity: | >95% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
