| Cas No.: | 2403733-82-2 |
| Chemical Name: | GLPG3970 |
| Synonyms: | 1(2H)-Isoquinolinone, 3,4-dihydro-8-methoxy-6-[7-[2-(4-morpholinyl)ethoxy]imidazo[1,2-a]pyridin-3-yl]-2-(2,2,2-trifluoroethyl)-;GLPG3970 |
| SMILES: | C1(=O)C2=C(C=C(C3N4C(=NC=3)C=C(OCCN3CCOCC3)C=C4)C=C2OC)CCN1CC(F)(F)F |
| Formula: | C25H27F3N4O4 |
| M.Wt: | 504.501496553421 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
