To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 508186-14-9 |
| Chemical Name: | 1-(2,3-Di(thiophen-2-yl)quinoxalin-6-yl)-3-(2-methoxyethyl)urea |
| Synonyms: | 1-(2,3-Di(thiophen-2-yl)quinoxalin-6-yl)-3-(2-methoxyethyl)urea;Ac-CoA Synthase Inhibitor1;Ac-COA Synthase Inhibitor;AK153939;1-(2,3-dithiophen-2-ylquinoxalin-6-yl)-3-(2-methoxyethyl)urea;acss2-inhibitor;MLS000534714;Ac-CoA Synthase Inhibitor I;Ac-CoA Synthase Inhibitor 1;HMS2326G04;BCP20716;SMR000142131;HY- |
| SMILES: | S1C([H])=C([H])C([H])=C1C1C(C2=C([H])C([H])=C([H])S2)=NC2C([H])=C([H])C(=C([H])C=2N=1)N([H])C(N([H])C([H])([H])C([H])([H])OC([H])([H])[H])=O |
| Formula: | C20H18N4O2S2 |
| M.Wt: | 410.5125 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Ac-CoA Synthase Inhibitor1 is an anti-virus agent. |
| In Vitro: | Ac-CoA Synthase Inhibitor1 inhibits the respiratory syncytial virus (RSV)[1]. |
| References: | [1]. Bill Severson, et al. Anti-viral treatment and assay to screen for anti-viral agent. WO 2011097607 A1 |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|