To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 1000308-25-7 |
| Chemical Name: | N-(((1R)-6-(3-fluorobenzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl)methyl)urea |
| Synonyms: | RO-5025181;SYN-120 |
| SMILES: | N(C[C@@H]1C2=C(C=C(S(C3=CC=CC(F)=C3)(=O)=O)C=C2)CCC1)C(N)=O |
| Formula: | C18H19FN2O3S |
| M.Wt: | 362.419 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A novel 5-HT receptor antagonist for the treatment of Parkinson's disease. |
