To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 2310392-52-8 |
| Chemical Name: | P2X2/3 Receptor antagonist |
| Synonyms: | P2X2/3 receptor antagonist |
| SMILES: | O(C1=C([H])N=C(N([H])[H])N=C1N([H])[H])C1C([H])=C(C#C[H])N=C([H])C=1C([H])(C([H])([H])[H])C([H])([H])[H] |
| Formula: | C14H15N5O |
| M.Wt: | 269.3018 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A novel P2X3 and P2X2/3 receptor antagonist useful for the treatmentof urinary tract diseases, pain, respiratory diseases and cardiovascular diseases. |
| In Vitro: | A novel P2X3 and P2X2/3 receptor antagonist useful for the treatmentof urinary tract diseases, pain, respiratory diseases and cardiovascular diseases. IC50 value of 0.0881 mM and 0.2490 mM towardsP2X3 and P2X2/3 receptor resp. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|