| Cas No.: | 2204289-53-0 |
| Chemical Name: | SHIN 2, SHIN-2 |
| Synonyms: | 6-Amino-4-(3-(hydroxymethyl)-5-(5-hydroxypent-1-yn-1-yl)phenyl)-4-isopropyl-3-methyl-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES: | N#CC(C1(C2=CC(C#CCCCO)=CC(CO)=C2)C(C)C)=C(N)OC3=C1C(C)=NN3 |
| Formula: | C23H26N4O3 |
| M.Wt: | 406.49 |
| Purity: | >98% |
| Sotrage: | 0°C (short term), -20°C (long term), desiccated |
| Publication: | 1) Juan C. García-Cañaveras et. eal., SHMT inhibition is effective and synergizes with methotrexate in T-cell acute lymphoblastic leukemia, Leukemia volume 35, pages377–388 (2021) |
| Description: | SHIN-2 is a novel SHMT inhibitor, increasing survival in NOTCH1-driven mouse primary T-ALL in vivo |
| References: | 1) Juan C. García-Cañaveras et. eal., SHMT inhibition is effective and synergizes with methotrexate in T-cell acute lymphoblastic leukemia, Leukemia volume 35, pages377–388 (2021) |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
