To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 222295-76-3 |
| Chemical Name: | [2H3]-Cyclosporine A |
| Synonyms: | Cyclosporin A, 6-[(2S,3R,4R,6E)-3-hydroxy-4-methyl-2-(methylamino)-6-octenoic-8,8,8-d3 acid]- (9CI) |
| SMILES: | [C@@H]([C@@]1([H])C(N[C@H](C(N(CC(N([C@H](C(N[C@]([H])(C(N([C@H](C(=O)N[C@@H](C)C(=O)N[C@H](C)C(=O)N(C)[C@@]([H])(CC(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@@]([H])(C(C)C)C(=O)N1C)CC(C)C)C)=O)C(C)C)=O)CC(C)C)C)=O)C)=O)CC)=O)(O)[C@H](C)C/C=C/C([H])([H])[H] |
| Formula: | C62H111N11O12 |
| M.Wt: | 1202.61 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |