| Cas No.: | 1239233-86-3 |
| Chemical Name: | Febuxostat amide impurity |
| SMILES: | O=C(C1=C(C)N=C(C2=CC=C(OCC(C)C)C(C(N)=O)=C2)S1)O |
| Formula: | C16H18N2O4S |
| M.Wt: | 334.39 |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
