To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 2973762-16-0 |
| Chemical Name: | Sjpyt-195 |
| Synonyms: | SJPYT195;CHEMBL5172753;GLXC-25989;SCHEMBL26732477;N-(3-(tert-Butyl)-5-((2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)oxy)phenyl)-1-(2,5-dimethoxyphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide;CS-0534878;SJPYT-195;G76732 |
| SMILES: | O(C1=CC(=CC(=C1)C(C)(C)C)NC(C1=C(C)N(C2C=C(C=CC=2OC)OC)N=N1)=O)C1=CC=CC2C(N(C(C=21)=O)C1C(NC(CC1)=O)=O)=O |
| Formula: | C35H34N6O8 |
| M.Wt: | 666.679868221283 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |