To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 2407654-51-5 |
| Chemical Name: | ZXH-1-161 |
| Synonyms: | 2,6-Piperidinedione, 3-[4-[[2-[(2,3-dihydro-1H-inden-5-yl)amino]-4-pyrimidinyl]amino]-1,3-dihydro-1-oxo-2H-isoindol-2-yl]-;ZXH-1-161 |
| SMILES: | N1C(=O)CCC(N2CC3=C(C2=O)C=CC=C3NC2C=CN=C(NC3C=CC4=C(C=3)CCC4)N=2)C1=O |
| Formula: | C26H24N6O3 |
| M.Wt: | 468.507164955139 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
