To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 178429-65-7 |
| Chemical Name: | JZP-110 hydrochloride |
| Synonyms: | Solriamfetol hydrochloride;Solriamfetol (hydrochloride);K7RO88SP7A;Solriamfetol hydrochloride [USAN];Solriamfetol hydrochloride (USAN);Sunosi (TN);KAOVAAHCFNYXNJ-SBSPUUFOSA-N;SB19103;O-Carbamoyl-(D)-phenylalaninol hydrochloride;D11328;(betaR)-beta-amino-Benzenepropanol 1-carbamate hydrochloride (1:1);JZP-110 hydrochloride |
| SMILES: | Cl[H].O(C(N([H])[H])=O)C([H])([H])[C@@]([H])(C([H])([H])C1C([H])=C([H])C([H])=C([H])C=1[H])N([H])[H] |
| Formula: | C10H15ClN2O2 |
| M.Wt: | 230.6913 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Solriamfetol (JZP-110) is a selective dopamine and norepinephrine reuptake inhibitor with robust wake-promoting effects. Solriamfetol binds to dopamine and norepinephrine transporters, so it can inhibit reuptake of dopamine and norepinephrine. Solriamfetol treatment significantly improves the ability to stay awake and subjective symptoms of excessive sleepiness in adults with narcolepsy. |
| References: | [1]. Yang J, et al. Solriamfetol for the treatment of excessive daytime sleepiness associated with narcolepsy. Expert Rev Clin Pharmacol. 2019 Aug;12(8):723-728. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|