To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
-AHPC-PEG4-N3.gif)
| Cas No.: | 1797406-81-5 |
| Chemical Name: | (S,R,S)-AHPC-PEG4-N3 |
| Synonyms: | (S,R,S)-AHPC-PEG4-N3;E3 ligase Ligand-Linker Conjugates 4;(S,R,S)-AHPC-PEG4-Azide;BCP33419;XWC40681;VH032-PEG4-N3; VHL Ligand-Linker Conjugates 5; E3 ligase Ligand-Linker Conjugates 4;(2S,4R)-1-[(2S)-2-[[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]acetyl]amino]-3,3-dime |
| SMILES: | S1C=NC(C)=C1C1C=CC(=CC=1)CNC([C@@H]1C[C@H](CN1C([C@H](C(C)(C)C)NC(COCCOCCOCCOCCN=[N+]=[N-])=O)=O)O)=O |
| Formula: | C32H47N7O8S |
| M.Wt: | 689.82 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |