| Cas No.: | 1421523-00-3 |
| Chemical Name: | 1-(4-{[(4-methoxyphenyl)sulfanyl]methyl}piperidin-1-yl)-2-[4-(propane-2-sulfonyl)phenyl]ethan-1-one |
| Synonyms: | 1-[4-[(4-methoxyphenyl)sulfanylmethyl]piperidin-1-yl]-2-(4-propan-2-ylsulfonylphenyl)ethanone;1-(4-{[(4-methoxyphenyl)sulfanyl]methyl}piperidin-1-yl)-2-[4-(propane-2-sulfonyl)phenyl]ethan-1-one |
| SMILES: | C(N1CCC(CSC2=CC=C(OC)C=C2)CC1)C(=O)C1=CC=C(S(C(C)C)(=O)=O)C=C1 |
| Formula: | C24H31NO4S2 |
| M.Wt: | 461.637244462967 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
