To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 2389149-74-8 |
| Chemical Name: | Mobocertinib succinate |
| Synonyms: | Mobocertinib (succinate);Mobocertinib succinate;BCP33315;TAK-788 succinate;AP32788 succinate |
| SMILES: | O(C([H])([H])[H])C1C([H])=C(C(=C([H])C=1N([H])C1=NC([H])=C(C(=O)OC([H])(C([H])([H])[H])C([H])([H])[H])C(C2=C([H])N(C([H])([H])[H])C3=C([H])C([H])=C([H])C([H])=C23)=N1)N([H])C(C([H])=C([H])[H])=O)N(C([H])([H])[H])C([H])([H])C([H])([H])N(C([H])([H])[H])C([H])([H])[H].O([H])C(C([H])([H])C([H])([H])C(=O)O[H])=O |
| Formula: | C36H45N7O8 |
| M.Wt: | 703.7846 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Mobocertinib succinate (compound A) is a potent epidermal growth factor receptor (EGFR) inhibitor and an antineoplastic agent, extracted from patent WO2019222093A1, compound A[1][2]. |
| References: | [1]. International Nonproprietary Names for Pharmaceutical Substances (INN). [2]. Landon J. DURAK, et al. Pharmaceutical salts of pyrimidine derivatives and method of treating disorders. WO2019222093A1. |
MSDS
COA
| LOT NO. | DOWNLOAD |
| 2018-0101 |
|
|
|