To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 137056-72-5 |
| Chemical Name: | 3-β-N-(N’,N’-Dimethylaminoethane)-carbamoylcholesterol |
| Synonyms: | 3BETA-[N-(N',N'-DIMETHYLAMINOETHANE)-CARBAMOYL]CHOLESTEROL,;3β-[N-(N',N'-Dimethylaminoethane)-carbamoyl]cholesterol;3β[N-(N',N'-Dimethylaminoethane)-carbamoyl]cholesterol;3-β-[N-(N’,N’-Dimethylaminoethane)-carbamoyl]cholesterol;DC-cholesterol;3β-{N-[2-(Dimethylamino)ethyl]carbamoyl}cholesterol;DC-Chol |
| SMILES: | CN(CCNC(O[C@H]1CC[C@@]2([C@H]3CC[C@@]4([C@H](CC[C@H]4[C@@H]3CC=C2C1)[C@@H](CCCC(C)C)C)C)C)=O)C |
| Formula: | C32H56N2O2 |
| M.Wt: | 500.79924 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |