| Cas No.: | 1379822-04-4 |
| Chemical Name: | Suc-Ile-Glu(γ-pip)-Gly-Arg-pNA hydrochloride |
| Synonyms: | {Suc}-I-{Glu(γ-pip)}-GR-pNA |
| SMILES: | CC[C@H](C)[C@H](NC(=O)CCC(=O)O)C(=O)N[C@@H](CCC(=O)N1CCCCC1)C(=O)NCC(=O)N[C@@H](CCCNC(=N)N)C(=O)NC1=CC=C([N+](=O)[O-])C=C1.Cl |
| Formula: | C34H53ClN10O10 |
| M.Wt: | 797.30 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
-Gly-Arg-pNA hydrochloride.gif)